C24H30O3 — CID 163002742
(8-formyl-4a-methyl-2-propan-2-yl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-1-yl) 3-phenylprop-2-enoate (PubChem CID 163002742) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is (8-formyl-4a-methyl-2-propan-2-yl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-1-yl) 3-phenylprop-2-enoate.
| Compound Name | (8-formyl-4a-methyl-2-propan-2-yl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-1-yl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 163002742 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (8-formyl-4a-methyl-2-propan-2-yl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-1-yl) 3-phenylprop-2-enoate |
| SMILES | CC(C)C1CCC2(C)CCC=C(C=O)C2C1OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C24H30O3/c1-17(2)20-13-15-24(3)14-7-10-19(16-25)22(24)23(20)27-21(26)12-11-18-8-5-4-6-9-18/h4-6,8-12,16-17,20,22-23H,7,13-15H2,1-3H3 |
| InChIKey | QAPDDLVCXDEXCQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|