C40H60O4 — CID 11169395
[4-[(E)-3-[[(1S,2S,4aR,8aS)-4a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl]oxy]-3-oxoprop-1-enyl]phenyl] (Z)-hexadec-9-enoate (PubChem CID 11169395) has the molecular formula C40H60O4 and a molecular weight of 604.92 g/mol. Its IUPAC name is [4-[(E)-3-[[(1S,2S,4aR,8aS)-4a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl]oxy]-3-oxoprop-1-enyl]phenyl] (Z)-hexadec-9-enoate.
| Compound Name | [4-[(E)-3-[[(1S,2S,4aR,8aS)-4a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl]oxy]-3-oxoprop-1-enyl]phenyl] (Z)-hexadec-9-enoate |
|---|---|
| PubChem CID | 11169395 |
| Molecular Formula | C40H60O4 |
| Molecular Weight | 604.92 g/mol |
| Exact Mass | 604.45 |
| IUPAC Name | [4-[(E)-3-[[(1S,2S,4aR,8aS)-4a-methyl-8-methylidene-2-propan-2-yl-1,2,3,4,5,6,7,8a-octahydronaphthalen-1-yl]oxy]-3-oxoprop-1-enyl]phenyl] (Z)-hexadec-9-enoate |
| SMILES | C=C1CCC[C@]2(C)CC[C@@H](C(C)C)[C@H](OC(=O)/C=C/c3ccc(OC(=O)CCCCCCC/C=C\CCCCCC)cc3)[C@@H]12 |
| InChI | InChI=1S/C40H60O4/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-21-36(41)43-34-25-22-33(23-26-34)24-27-37(42)44-39-35(31(2)3)28-30-40(5)29-19-20-32(4)38(39)40/h11-12,22-27,31,35,38-39H,4,6-10,13-21,28-30H2,1-3,5H3/b12-11-,27-24+/t35-,38+,39-,40+/m0/s1 |
| InChIKey | KUDWENOBBNRHJO-JSFPXVGZSA-N |
| XLogP | 11.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.92 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|