C24H32O4 — CID 163028114
(4-hydroxy-6,10-dimethyl-3-propan-2-yl-11-oxabicyclo[8.1.0]undec-6-en-2-yl) 3-phenylprop-2-enoate (PubChem CID 163028114) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is (4-hydroxy-6,10-dimethyl-3-propan-2-yl-11-oxabicyclo[8.1.0]undec-6-en-2-yl) 3-phenylprop-2-enoate.
| Compound Name | (4-hydroxy-6,10-dimethyl-3-propan-2-yl-11-oxabicyclo[8.1.0]undec-6-en-2-yl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 163028114 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (4-hydroxy-6,10-dimethyl-3-propan-2-yl-11-oxabicyclo[8.1.0]undec-6-en-2-yl) 3-phenylprop-2-enoate |
| SMILES | CC1=CCCC2(C)OC2C(OC(=O)C=Cc2ccccc2)C(C(C)C)C(O)C1 |
| InChI | InChI=1S/C24H32O4/c1-16(2)21-19(25)15-17(3)9-8-14-24(4)23(28-24)22(21)27-20(26)13-12-18-10-6-5-7-11-18/h5-7,9-13,16,19,21-23,25H,8,14-15H2,1-4H3 |
| InChIKey | RQUKRNBIOPTYHH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|