C21H26O — CID 139080818
(E)-1-[(2S,4aS,8aS)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]-3-phenylprop-2-en-1-one (PubChem CID 139080818) has the molecular formula C21H26O and a molecular weight of 294.44 g/mol. Its IUPAC name is (E)-1-[(2S,4aS,8aS)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(2S,4aS,8aS)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 139080818 |
| Molecular Formula | C21H26O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (E)-1-[(2S,4aS,8aS)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]-3-phenylprop-2-en-1-one |
| SMILES | CC1=CCC[C@@]2(C)CC[C@H](C(=O)/C=C/c3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C21H26O/c1-16-7-6-13-21(2)14-12-18(15-19(16)21)20(22)11-10-17-8-4-3-5-9-17/h3-5,7-11,18-19H,6,12-15H2,1-2H3/b11-10+/t18-,19+,21-/m0/s1 |
| InChIKey | ZIMGSPNDOUHTLN-WSSLVXAKSA-N |
| XLogP | 5.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|