C13H15NO — CID 85352934
1-(2,2-dimethylaziridin-1-yl)-3-phenylprop-2-en-1-one (PubChem CID 85352934) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-(2,2-dimethylaziridin-1-yl)-3-phenylprop-2-en-1-one.
| Compound Name | 1-(2,2-dimethylaziridin-1-yl)-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 85352934 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1-(2,2-dimethylaziridin-1-yl)-3-phenylprop-2-en-1-one |
| SMILES | CC1(C)CN1C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C13H15NO/c1-13(2)10-14(13)12(15)9-8-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3 |
| InChIKey | HOLDHZGZZGZFDY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|