C20H22N2O — CID 4632079
6,7-dimethyl-4-(3-phenylprop-2-enoyl)-4-azatricyclo[4.3.0.03,7]nonane-3-carbonitrile (PubChem CID 4632079) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 6,7-dimethyl-4-(3-phenylprop-2-enoyl)-4-azatricyclo[4.3.0.03,7]nonane-3-carbonitrile.
| Compound Name | 6,7-dimethyl-4-(3-phenylprop-2-enoyl)-4-azatricyclo[4.3.0.03,7]nonane-3-carbonitrile |
|---|---|
| PubChem CID | 4632079 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 6,7-dimethyl-4-(3-phenylprop-2-enoyl)-4-azatricyclo[4.3.0.03,7]nonane-3-carbonitrile |
| SMILES | CC12CN(C(=O)C=Cc3ccccc3)C3(C#N)CC1CCC23C |
| InChI | InChI=1S/C20H22N2O/c1-18-14-22(17(23)9-8-15-6-4-3-5-7-15)20(13-21)12-16(18)10-11-19(18,20)2/h3-9,16H,10-12,14H2,1-2H3 |
| InChIKey | TWXCSCAEJMCBEC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|