C19H23NO3S — CID 150421939
1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-5-yl)-3-phenylprop-2-en-1-one (PubChem CID 150421939) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is 1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-5-yl)-3-phenylprop-2-en-1-one.
| Compound Name | 1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-5-yl)-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 150421939 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-5-yl)-3-phenylprop-2-en-1-one |
| SMILES | CC1(C)C2CCC13CS(=O)(=O)NC3(C(=O)C=Cc1ccccc1)C2 |
| InChI | InChI=1S/C19H23NO3S/c1-17(2)15-10-11-18(17)13-24(22,23)20-19(18,12-15)16(21)9-8-14-6-4-3-5-7-14/h3-9,15,20H,10-13H2,1-2H3 |
| InChIKey | HHYXTSVTDUIGCA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|