C17H22N2O2S — CID 135014855
(6R,7E)-7-benzylidene-11,11-dimethyl-3λ6-thia-4,5-diazatricyclo[6.2.1.01,6]undecane 3,3-dioxide (PubChem CID 135014855) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is (6R,7E)-7-benzylidene-11,11-dimethyl-3λ6-thia-4,5-diazatricyclo[6.2.1.01,6]undecane 3,3-dioxide.
| Compound Name | (6R,7E)-7-benzylidene-11,11-dimethyl-3λ6-thia-4,5-diazatricyclo[6.2.1.01,6]undecane 3,3-dioxide |
|---|---|
| PubChem CID | 135014855 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (6R,7E)-7-benzylidene-11,11-dimethyl-3λ6-thia-4,5-diazatricyclo[6.2.1.01,6]undecane 3,3-dioxide |
| SMILES | CC1(C)C2CCC13CS(=O)(=O)NN[C@@H]3/C2=C/c1ccccc1 |
| InChI | InChI=1S/C17H22N2O2S/c1-16(2)14-8-9-17(16)11-22(20,21)19-18-15(17)13(14)10-12-6-4-3-5-7-12/h3-7,10,14-15,18-19H,8-9,11H2,1-2H3/b13-10+/t14?,15-,17?/m1/s1 |
| InChIKey | JXYOBFNVCZMLMT-SBVLVVAXSA-N |
| XLogP | 2.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |