About (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one
(3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 18805078) has the molecular formula C17H20O
and a molecular weight of 240.35 g/mol. Its IUPAC name is (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
Molecular Properties
| Compound Name | (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| PubChem CID | 18805078 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(C(=O)/C1=C/c1ccccc1)C2(C)C |
| InChI | InChI=1S/C17H20O/c1-16(2)13-9-10-17(16,3)14(15(13)18)11-12-7-5-4-6-8-12/h4-8,11,13H,9-10H2,1-3H3/b14-11- |
| InChIKey | TYXBUJNJSURMOC-KAMYIIQDSA-N |
| XLogP | 4.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one?
The IUPAC name of (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one (CID 18805078) is (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
What is the SMILES notation for (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one?
The canonical SMILES for (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one is CC12CCC(C(=O)/C1=C/c1ccccc1)C2(C)C.
What is the InChIKey of (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one?
The InChIKey is TYXBUJNJSURMOC-KAMYIIQDSA-N. The full InChI is InChI=1S/C17H20O/c1-16(2)13-9-10-17(16,3)14(15(13)18)11-12-7-5-4-6-8-12/h4-8,11,13H,9-10H2,1-3H3/b14-11-.
What are the key properties of (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one?
(3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one has a molecular weight of 240.35 g/mol, XLogP of 4.10, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one is sourced from PubChem (CID 18805078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).