C17H20O — CID 18805078
(3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 18805078) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 18805078 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (3E)-3-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(C(=O)/C1=C/c1ccccc1)C2(C)C |
| InChI | InChI=1S/C17H20O/c1-16(2)13-9-10-17(16,3)14(15(13)18)11-12-7-5-4-6-8-12/h4-8,11,13H,9-10H2,1-3H3/b14-11- |
| InChIKey | TYXBUJNJSURMOC-KAMYIIQDSA-N |
| XLogP | 4.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|