C25H35N2O3S+ — CID 102206523
benzyl-[2-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-oxoethyl]-bis(prop-2-enyl)azanium (PubChem CID 102206523) has the molecular formula C25H35N2O3S+ and a molecular weight of 443.63 g/mol. Its IUPAC name is benzyl-[2-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-oxoethyl]-bis(prop-2-enyl)azanium.
| Compound Name | benzyl-[2-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-oxoethyl]-bis(prop-2-enyl)azanium |
|---|---|
| PubChem CID | 102206523 |
| Molecular Formula | C25H35N2O3S+ |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | benzyl-[2-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-oxoethyl]-bis(prop-2-enyl)azanium |
| SMILES | C=CC[N+](CC=C)(CC(=O)N1[C@H]2C[C@@H]3CC[C@@]2(CS1(=O)=O)C3(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C25H35N2O3S/c1-5-14-27(15-6-2,17-20-10-8-7-9-11-20)18-23(28)26-22-16-21-12-13-25(22,24(21,3)4)19-31(26,29)30/h5-11,21-22H,1-2,12-19H2,3-4H3/q+1/t21-,22-,25-/m0/s1 |
| InChIKey | YWGIFUUXQDZIHR-HWBMXIPRSA-N |
| XLogP | 3.74 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|