C22H29NO4S — CID 10644869
(Z)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-phenylmethoxypent-2-en-1-one (PubChem CID 10644869) has the molecular formula C22H29NO4S and a molecular weight of 403.54 g/mol. Its IUPAC name is (Z)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-phenylmethoxypent-2-en-1-one.
| Compound Name | (Z)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-phenylmethoxypent-2-en-1-one |
|---|---|
| PubChem CID | 10644869 |
| Molecular Formula | C22H29NO4S |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (Z)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-phenylmethoxypent-2-en-1-one |
| SMILES | CC1(C)[C@H]2CC[C@@]13CS(=O)(=O)N(C(=O)/C=C\CCOCc1ccccc1)[C@H]3C2 |
| InChI | InChI=1S/C22H29NO4S/c1-21(2)18-11-12-22(21)16-28(25,26)23(19(22)14-18)20(24)10-6-7-13-27-15-17-8-4-3-5-9-17/h3-6,8-10,18-19H,7,11-16H2,1-2H3/b10-6-/t18-,19-,22-/m0/s1 |
| InChIKey | DJTYXNMGBJNZSD-VAZJIRCXSA-N |
| XLogP | 3.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|