C29H36N2O4S — CID 11113921
(E,2S)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-(2-methylphenyl)-2-(phenylmethoxyamino)pent-4-en-1-one (PubChem CID 11113921) has the molecular formula C29H36N2O4S and a molecular weight of 508.68 g/mol. Its IUPAC name is (E,2S)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-(2-methylphenyl)-2-(phenylmethoxyamino)pent-4-en-1-one.
| Compound Name | (E,2S)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-(2-methylphenyl)-2-(phenylmethoxyamino)pent-4-en-1-one |
|---|---|
| PubChem CID | 11113921 |
| Molecular Formula | C29H36N2O4S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | (E,2S)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-(2-methylphenyl)-2-(phenylmethoxyamino)pent-4-en-1-one |
| SMILES | Cc1ccccc1/C=C/C[C@H](NOCc1ccccc1)C(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C29H36N2O4S/c1-21-10-7-8-13-23(21)14-9-15-25(30-35-19-22-11-5-4-6-12-22)27(32)31-26-18-24-16-17-29(26,28(24,2)3)20-36(31,33)34/h4-14,24-26,30H,15-20H2,1-3H3/b14-9+/t24-,25+,26-,29-/m1/s1 |
| InChIKey | XLTKSLLEVRVWHK-IDNFIIHYSA-N |
| XLogP | 4.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|