C23H32N2O3S3 — CID 11583849
(2R)-2-benzyl-3-[bis(methylsulfanyl)methylideneamino]-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]propan-1-one (PubChem CID 11583849) has the molecular formula C23H32N2O3S3 and a molecular weight of 480.72 g/mol. Its IUPAC name is (2R)-2-benzyl-3-[bis(methylsulfanyl)methylideneamino]-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]propan-1-one.
| Compound Name | (2R)-2-benzyl-3-[bis(methylsulfanyl)methylideneamino]-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]propan-1-one |
|---|---|
| PubChem CID | 11583849 |
| Molecular Formula | C23H32N2O3S3 |
| Molecular Weight | 480.72 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | (2R)-2-benzyl-3-[bis(methylsulfanyl)methylideneamino]-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]propan-1-one |
| SMILES | CSC(=NC[C@@H](Cc1ccccc1)C(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C)SC |
| InChI | InChI=1S/C23H32N2O3S3/c1-22(2)18-10-11-23(22)15-31(27,28)25(19(23)13-18)20(26)17(14-24-21(29-3)30-4)12-16-8-6-5-7-9-16/h5-9,17-19H,10-15H2,1-4H3/t17-,18-,19-,23-/m1/s1 |
| InChIKey | UCMCMAHLDNURGC-FZONSQQESA-N |
| XLogP | 4.29 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.72 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|