C20H27NO4S — CID 10872540
(2S,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-hydroxy-2-methyl-3-phenylpropan-1-one (PubChem CID 10872540) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is (2S,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-hydroxy-2-methyl-3-phenylpropan-1-one.
| Compound Name | (2S,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-hydroxy-2-methyl-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 10872540 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (2S,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-hydroxy-2-methyl-3-phenylpropan-1-one |
| SMILES | C[C@H](C(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H27NO4S/c1-13(17(22)14-7-5-4-6-8-14)18(23)21-16-11-15-9-10-20(16,19(15,2)3)12-26(21,24)25/h4-8,13,15-17,22H,9-12H2,1-3H3/t13-,15+,16+,17+,20+/m0/s1 |
| InChIKey | OUWZADZEGLXJJW-SOETTZPCSA-N |
| XLogP | 2.72 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |