C13H21NO5S — CID 11088001
(2S)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-hydroxy-2-methoxyethanone (PubChem CID 11088001) has the molecular formula C13H21NO5S and a molecular weight of 303.38 g/mol. Its IUPAC name is (2S)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-hydroxy-2-methoxyethanone.
| Compound Name | (2S)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-hydroxy-2-methoxyethanone |
|---|---|
| PubChem CID | 11088001 |
| Molecular Formula | C13H21NO5S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (2S)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-hydroxy-2-methoxyethanone |
| SMILES | CO[C@H](O)C(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C13H21NO5S/c1-12(2)8-4-5-13(12)7-20(17,18)14(9(13)6-8)10(15)11(16)19-3/h8-9,11,16H,4-7H2,1-3H3/t8-,9-,11+,13-/m1/s1 |
| InChIKey | JTMSVAFVXBFFIR-MBJVOQIVSA-N |
| XLogP | 0.32 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|