C18H27NO5S — CID 11199506
(3R)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]heptane-2,6-dione (PubChem CID 11199506) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is (3R)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]heptane-2,6-dione.
| Compound Name | (3R)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]heptane-2,6-dione |
|---|---|
| PubChem CID | 11199506 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (3R)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]heptane-2,6-dione |
| SMILES | CC(=O)CC[C@H](C(C)=O)C(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C18H27NO5S/c1-11(20)5-6-14(12(2)21)16(22)19-15-9-13-7-8-18(15,17(13,3)4)10-25(19,23)24/h13-15H,5-10H2,1-4H3/t13-,14-,15-,18-/m1/s1 |
| InChIKey | GEGKRDWPLHPVBT-ATNYBXOESA-N |
| XLogP | 1.93 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|