C17H29NO3S — CID 99961952
(3R)-1-[(1R,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methylhexan-1-one (PubChem CID 99961952) has the molecular formula C17H29NO3S and a molecular weight of 327.49 g/mol. Its IUPAC name is (3R)-1-[(1R,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methylhexan-1-one.
| Compound Name | (3R)-1-[(1R,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methylhexan-1-one |
|---|---|
| PubChem CID | 99961952 |
| Molecular Formula | C17H29NO3S |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | (3R)-1-[(1R,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methylhexan-1-one |
| SMILES | CCC[C@@H](C)CC(=O)N1[C@H]2C[C@H]3CC[C@@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C17H29NO3S/c1-5-6-12(2)9-15(19)18-14-10-13-7-8-17(14,16(13,3)4)11-22(18,20)21/h12-14H,5-11H2,1-4H3/t12-,13-,14+,17+/m1/s1 |
| InChIKey | SWNASHKJCPORGA-WVZRYYJFSA-N |
| XLogP | 3.18 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |