C19H32F2NO6PS — CID 10576357
(3S)-4-diethoxyphosphoryl-1-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-4,4-difluoro-3-methylbutan-1-one (PubChem CID 10576357) has the molecular formula C19H32F2NO6PS and a molecular weight of 471.50 g/mol. Its IUPAC name is (3S)-4-diethoxyphosphoryl-1-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-4,4-difluoro-3-methylbutan-1-one.
| Compound Name | (3S)-4-diethoxyphosphoryl-1-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-4,4-difluoro-3-methylbutan-1-one |
|---|---|
| PubChem CID | 10576357 |
| Molecular Formula | C19H32F2NO6PS |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | (3S)-4-diethoxyphosphoryl-1-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-4,4-difluoro-3-methylbutan-1-one |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@@H](C)CC(=O)N1[C@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C19H32F2NO6PS/c1-6-27-29(24,28-7-2)19(20,21)13(3)10-16(23)22-15-11-14-8-9-18(15,17(14,4)5)12-30(22,25)26/h13-15H,6-12H2,1-5H3/t13-,14+,15-,18+/m0/s1 |
| InChIKey | RMUFCOWBXNLQCO-JTOWHCCKSA-N |
| XLogP | 4.24 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|