C19H31NO5S — CID 90397135
1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-hydroxy-4,4-dimethylheptane-1,5-dione (PubChem CID 90397135) has the molecular formula C19H31NO5S and a molecular weight of 385.53 g/mol. Its IUPAC name is 1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-hydroxy-4,4-dimethylheptane-1,5-dione.
| Compound Name | 1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-hydroxy-4,4-dimethylheptane-1,5-dione |
|---|---|
| PubChem CID | 90397135 |
| Molecular Formula | C19H31NO5S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-hydroxy-4,4-dimethylheptane-1,5-dione |
| SMILES | CCC(=O)C(C)(C)C(O)CC(=O)N1[C@H]2C[C@@H]3CC[C@@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C19H31NO5S/c1-6-14(21)17(2,3)15(22)10-16(23)20-13-9-12-7-8-19(13,18(12,4)5)11-26(20,24)25/h12-13,15,22H,6-11H2,1-5H3/t12-,13-,15?,19-/m0/s1 |
| InChIKey | NZGSUIAICNMDAV-KQEVFFEASA-N |
| XLogP | 2.11 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |