C15H22Cl3NO3S — CID 11047713
(3S)-4,4,4-trichloro-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methylbutan-1-one (PubChem CID 11047713) has the molecular formula C15H22Cl3NO3S and a molecular weight of 402.77 g/mol. Its IUPAC name is (3S)-4,4,4-trichloro-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methylbutan-1-one.
| Compound Name | (3S)-4,4,4-trichloro-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 11047713 |
| Molecular Formula | C15H22Cl3NO3S |
| Molecular Weight | 402.77 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | (3S)-4,4,4-trichloro-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methylbutan-1-one |
| SMILES | C[C@@H](CC(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H22Cl3NO3S/c1-9(15(16,17)18)6-12(20)19-11-7-10-4-5-14(11,13(10,2)3)8-23(19,21)22/h9-11H,4-8H2,1-3H3/t9-,10+,11+,14+/m0/s1 |
| InChIKey | NJGUOFIKIYEQSZ-ICUOPCATSA-N |
| XLogP | 3.75 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.77 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|