C25H41NO6S — CID 91460703
(3S,6R,7S,8S)-1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-3,7-dihydroxy-4,4,6,8-tetramethylundec-9-ene-1,5-dione (PubChem CID 91460703) has the molecular formula C25H41NO6S and a molecular weight of 483.67 g/mol. Its IUPAC name is (3S,6R,7S,8S)-1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-3,7-dihydroxy-4,4,6,8-tetramethylundec-9-ene-1,5-dione.
| Compound Name | (3S,6R,7S,8S)-1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-3,7-dihydroxy-4,4,6,8-tetramethylundec-9-ene-1,5-dione |
|---|---|
| PubChem CID | 91460703 |
| Molecular Formula | C25H41NO6S |
| Molecular Weight | 483.67 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | (3S,6R,7S,8S)-1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-3,7-dihydroxy-4,4,6,8-tetramethylundec-9-ene-1,5-dione |
| SMILES | CC=C[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)N1C2CC3CCC2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C25H41NO6S/c1-8-9-15(2)21(29)16(3)22(30)23(4,5)19(27)13-20(28)26-18-12-17-10-11-25(18,24(17,6)7)14-33(26,31)32/h8-9,15-19,21,27,29H,10-14H2,1-7H3/t15-,16+,17?,18?,19-,21-,25?/m0/s1 |
| InChIKey | YTVQABDNDSRFPB-MZHLKLBESA-N |
| XLogP | 2.91 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.67 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|