C19H31NO4S — CID 135029785
(2S,3S,4R)-1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-3-hydroxy-2,4-dimethylhept-6-en-1-one (PubChem CID 135029785) has the molecular formula C19H31NO4S and a molecular weight of 369.53 g/mol. Its IUPAC name is (2S,3S,4R)-1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-3-hydroxy-2,4-dimethylhept-6-en-1-one.
| Compound Name | (2S,3S,4R)-1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-3-hydroxy-2,4-dimethylhept-6-en-1-one |
|---|---|
| PubChem CID | 135029785 |
| Molecular Formula | C19H31NO4S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | (2S,3S,4R)-1-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-3-hydroxy-2,4-dimethylhept-6-en-1-one |
| SMILES | C=CC[C@@H](C)[C@H](O)[C@H](C)C(=O)N1C2CC3CCC2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C19H31NO4S/c1-6-7-12(2)16(21)13(3)17(22)20-15-10-14-8-9-19(15,18(14,4)5)11-25(20,23)24/h6,12-16,21H,1,7-11H2,2-5H3/t12-,13+,14?,15?,16+,19?/m1/s1 |
| InChIKey | DRXFXYCMOSIICF-UJCJHJMASA-N |
| XLogP | 2.56 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|