C19H30N2O3S — CID 102206528
(2R)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-[methyl(prop-2-enyl)amino]pent-4-en-1-one (PubChem CID 102206528) has the molecular formula C19H30N2O3S and a molecular weight of 366.53 g/mol. Its IUPAC name is (2R)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-[methyl(prop-2-enyl)amino]pent-4-en-1-one.
| Compound Name | (2R)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-[methyl(prop-2-enyl)amino]pent-4-en-1-one |
|---|---|
| PubChem CID | 102206528 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (2R)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-[methyl(prop-2-enyl)amino]pent-4-en-1-one |
| SMILES | C=CC[C@H](C(=O)N1[C@H]2C[C@@H]3CC[C@@]2(CS1(=O)=O)C3(C)C)N(C)CC=C |
| InChI | InChI=1S/C19H30N2O3S/c1-6-8-15(20(5)11-7-2)17(22)21-16-12-14-9-10-19(16,18(14,3)4)13-25(21,23)24/h6-7,14-16H,1-2,8-13H2,3-5H3/t14-,15+,16-,19-/m0/s1 |
| InChIKey | KXPIXMSXTHQOJA-RCJHGTSTSA-N |
| XLogP | 2.42 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|