C15H23NO3S — CID 162473195
1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methylbut-2-en-1-one (PubChem CID 162473195) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methylbut-2-en-1-one.
| Compound Name | 1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 162473195 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-methylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)N1[C@H]2C[C@@H]3CC[C@@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C15H23NO3S/c1-10(2)7-13(17)16-12-8-11-5-6-15(12,14(11,3)4)9-20(16,18)19/h7,11-12H,5-6,8-9H2,1-4H3/t11-,12-,15-/m0/s1 |
| InChIKey | AYOJINYBXAATQF-HUBLWGQQSA-N |
| XLogP | 2.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|