C19H30BNO5S — CID 11133019
(E)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-one (PubChem CID 11133019) has the molecular formula C19H30BNO5S and a molecular weight of 395.33 g/mol. Its IUPAC name is (E)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 11133019 |
| Molecular Formula | C19H30BNO5S |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | (E)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-one |
| SMILES | CC1(C)OB(/C=C/C(=O)N2[C@@H]3C[C@H]4CC[C@]3(CS2(=O)=O)C4(C)C)OC1(C)C |
| InChI | InChI=1S/C19H30BNO5S/c1-16(2)13-7-9-19(16)12-27(23,24)21(14(19)11-13)15(22)8-10-20-25-17(3,4)18(5,6)26-20/h8,10,13-14H,7,9,11-12H2,1-6H3/b10-8+/t13-,14-,19-/m1/s1 |
| InChIKey | CRQNVTJBPDJSBH-AXLCJBLXSA-N |
| XLogP | 2.54 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|