C20H25NO3S — CID 10713500
(E)-1-[(1R,5R,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-(4-methylphenyl)prop-2-en-1-one (PubChem CID 10713500) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is (E)-1-[(1R,5R,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[(1R,5R,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 10713500 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (E)-1-[(1R,5R,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-(4-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)N2[C@@H]3C[C@@H]4CC[C@@]3(CS2(=O)=O)C4(C)C)cc1 |
| InChI | InChI=1S/C20H25NO3S/c1-14-4-6-15(7-5-14)8-9-18(22)21-17-12-16-10-11-20(17,19(16,2)3)13-25(21,23)24/h4-9,16-17H,10-13H2,1-3H3/b9-8+/t16-,17+,20-/m0/s1 |
| InChIKey | TXOAVQJLPQOOEI-IAQSFYBOSA-N |
| XLogP | 3.38 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|