C20H26N2O4S — CID 134920672
(3E)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-phenylmethoxyiminopropan-1-one (PubChem CID 134920672) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is (3E)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-phenylmethoxyiminopropan-1-one.
| Compound Name | (3E)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-phenylmethoxyiminopropan-1-one |
|---|---|
| PubChem CID | 134920672 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (3E)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-phenylmethoxyiminopropan-1-one |
| SMILES | CC1(C)[C@H]2CC[C@@]13CS(=O)(=O)N(C(=O)C/C=N/OCc1ccccc1)[C@H]3C2 |
| InChI | InChI=1S/C20H26N2O4S/c1-19(2)16-8-10-20(19)14-27(24,25)22(17(20)12-16)18(23)9-11-21-26-13-15-6-4-3-5-7-15/h3-7,11,16-17H,8-10,12-14H2,1-2H3/b21-11+/t16-,17-,20-/m0/s1 |
| InChIKey | SNSIGNSULVHDQT-YXFUTMDZSA-N |
| XLogP | 2.95 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|