C20H26N2O3S — CID 10429508
(1-benzylaziridin-2-yl)-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]methanone (PubChem CID 10429508) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is (1-benzylaziridin-2-yl)-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]methanone.
| Compound Name | (1-benzylaziridin-2-yl)-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]methanone |
|---|---|
| PubChem CID | 10429508 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (1-benzylaziridin-2-yl)-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]methanone |
| SMILES | CC1(C)[C@H]2CC[C@@]13CS(=O)(=O)N(C(=O)C1CN1Cc1ccccc1)[C@H]3C2 |
| InChI | InChI=1S/C20H26N2O3S/c1-19(2)15-8-9-20(19)13-26(24,25)22(17(20)10-15)18(23)16-12-21(16)11-14-6-4-3-5-7-14/h3-7,15-17H,8-13H2,1-2H3/t15-,16?,17-,20-,21?/m0/s1 |
| InChIKey | LJGWNKPLKIJGBN-FFZPSUSOSA-N |
| XLogP | 2.24 |
| TPSA | 57.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|