C23H31BrN2O3SZn- — CID 102446434
CID 102446434 (PubChem CID 102446434) has the molecular formula C23H31BrN2O3SZn- and a molecular weight of 560.87 g/mol.
| Compound Name | CID 102446434 |
|---|---|
| PubChem CID | 102446434 |
| Molecular Formula | C23H31BrN2O3SZn- |
| Molecular Weight | 560.87 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | — |
| SMILES | [Br-].[CH2][C@@H]1CCN(Cc2ccccc2)[C@@H]1C(=O)N1C2C[C@@H]3CC[C@@]2(CS1(=O)=O)C3(C)C.[Zn] |
| InChI | InChI=1S/C23H31N2O3S.BrH.Zn/c1-16-10-12-24(14-17-7-5-4-6-8-17)20(16)21(26)25-19-13-18-9-11-23(19,22(18,2)3)15-29(25,27)28;;/h4-8,16,18-20H,1,9-15H2,2-3H3;1H;/p-1/t16-,18+,19?,20+,23+;;/m1../s1 |
| InChIKey | VGPHDEUXDDHMTI-PTOQYCGZSA-M |
| XLogP | 0.08 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.87 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|