C31H33N2O4PS — CID 101049840
[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-[(2R,3R)-1-diphenylphosphoryl-3-phenylaziridin-2-yl]methanone (PubChem CID 101049840) has the molecular formula C31H33N2O4PS and a molecular weight of 560.66 g/mol. Its IUPAC name is [(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-[(2R,3R)-1-diphenylphosphoryl-3-phenylaziridin-2-yl]methanone.
| Compound Name | [(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-[(2R,3R)-1-diphenylphosphoryl-3-phenylaziridin-2-yl]methanone |
|---|---|
| PubChem CID | 101049840 |
| Molecular Formula | C31H33N2O4PS |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | [(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-[(2R,3R)-1-diphenylphosphoryl-3-phenylaziridin-2-yl]methanone |
| SMILES | CC1(C)[C@H]2CC[C@@]13CS(=O)(=O)N(C(=O)[C@H]1[C@@H](c4ccccc4)N1P(=O)(c1ccccc1)c1ccccc1)[C@H]3C2 |
| InChI | InChI=1S/C31H33N2O4PS/c1-30(2)23-18-19-31(30)21-39(36,37)33(26(31)20-23)29(34)28-27(22-12-6-3-7-13-22)32(28)38(35,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-17,23,26-28H,18-21H2,1-2H3/t23-,26-,27+,28+,31-,32?/m0/s1 |
| InChIKey | GNJSDZAYKAHQLS-VDRDUWCHSA-N |
| XLogP | 4.71 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|