C20H24N2O3S2 — CID 71601707
[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone (PubChem CID 71601707) has the molecular formula C20H24N2O3S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is [(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone.
| Compound Name | [(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 71601707 |
| Molecular Formula | C20H24N2O3S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | [(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone |
| SMILES | CC1(C)[C@@H]2CC[C@]13CS(=O)(=O)N(C(=O)C1CSC(c4ccccc4)=N1)[C@@H]3C2 |
| InChI | InChI=1S/C20H24N2O3S2/c1-19(2)14-8-9-20(19)12-27(24,25)22(16(20)10-14)18(23)15-11-26-17(21-15)13-6-4-3-5-7-13/h3-7,14-16H,8-12H2,1-2H3/t14-,15?,16-,20-/m1/s1 |
| InChIKey | ZJCLQZJOQJIYGX-BZZYVRKASA-N |
| XLogP | 2.92 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |