C28H29N3O5S — CID 134927019
2-[(2S,3R)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-2-methyl-2-phenylaziridin-1-yl]isoindole-1,3-dione (PubChem CID 134927019) has the molecular formula C28H29N3O5S and a molecular weight of 519.62 g/mol. Its IUPAC name is 2-[(2S,3R)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-2-methyl-2-phenylaziridin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3R)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-2-methyl-2-phenylaziridin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134927019 |
| Molecular Formula | C28H29N3O5S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | 2-[(2S,3R)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-2-methyl-2-phenylaziridin-1-yl]isoindole-1,3-dione |
| SMILES | CC1(C)[C@@H]2CC[C@]13CS(=O)(=O)N(C(=O)[C@@H]1N(N4C(=O)c5ccccc5C4=O)[C@@]1(C)c1ccccc1)[C@@H]3C2 |
| InChI | InChI=1S/C28H29N3O5S/c1-26(2)18-13-14-28(26)16-37(35,36)30(21(28)15-18)25(34)22-27(3,17-9-5-4-6-10-17)31(22)29-23(32)19-11-7-8-12-20(19)24(29)33/h4-12,18,21-22H,13-16H2,1-3H3/t18-,21-,22+,27+,28-,31?/m1/s1 |
| InChIKey | IZFIAEHDHNMQPW-VRRQYYODSA-N |
| XLogP | 3.16 |
| TPSA | 94.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|