C21H21NO5S — CID 11090644
2-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]naphthalene-1,4-dione (PubChem CID 11090644) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]naphthalene-1,4-dione.
| Compound Name | 2-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 11090644 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 2-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]naphthalene-1,4-dione |
| SMILES | CC1(C)[C@@H]2CC[C@]13CS(=O)(=O)N(C(=O)C1=CC(=O)c4ccccc4C1=O)[C@H]3C2 |
| InChI | InChI=1S/C21H21NO5S/c1-20(2)12-7-8-21(20)11-28(26,27)22(17(21)9-12)19(25)15-10-16(23)13-5-3-4-6-14(13)18(15)24/h3-6,10,12,17H,7-9,11H2,1-2H3/t12-,17+,21-/m1/s1 |
| InChIKey | BTVSEPCHGNHYRY-LGZJRCCHSA-N |
| XLogP | 2.36 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|