C31H32BrN2O4PS — CID 101049862
[(2R,3R)-3-(3-bromophenyl)-1-diphenylphosphorylaziridin-2-yl]-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]methanone (PubChem CID 101049862) has the molecular formula C31H32BrN2O4PS and a molecular weight of 639.55 g/mol. Its IUPAC name is [(2R,3R)-3-(3-bromophenyl)-1-diphenylphosphorylaziridin-2-yl]-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]methanone.
| Compound Name | [(2R,3R)-3-(3-bromophenyl)-1-diphenylphosphorylaziridin-2-yl]-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]methanone |
|---|---|
| PubChem CID | 101049862 |
| Molecular Formula | C31H32BrN2O4PS |
| Molecular Weight | 639.55 g/mol |
| Exact Mass | 638.10 |
| IUPAC Name | [(2R,3R)-3-(3-bromophenyl)-1-diphenylphosphorylaziridin-2-yl]-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]methanone |
| SMILES | CC1(C)[C@H]2CC[C@@]13CS(=O)(=O)N(C(=O)[C@H]1[C@@H](c4cccc(Br)c4)N1P(=O)(c1ccccc1)c1ccccc1)[C@H]3C2 |
| InChI | InChI=1S/C31H32BrN2O4PS/c1-30(2)22-16-17-31(30)20-40(37,38)34(26(31)19-22)29(35)28-27(21-10-9-11-23(32)18-21)33(28)39(36,24-12-5-3-6-13-24)25-14-7-4-8-15-25/h3-15,18,22,26-28H,16-17,19-20H2,1-2H3/t22-,26-,27+,28+,31-,33?/m0/s1 |
| InChIKey | USNIOVWHMZITHH-ZAAZZPHJSA-N |
| XLogP | 5.47 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|