C18H20BrN3O3S — CID 101376119
2-(4-bromophenyl)-2-diazo-1-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]ethanone (PubChem CID 101376119) has the molecular formula C18H20BrN3O3S and a molecular weight of 438.35 g/mol. Its IUPAC name is 2-(4-bromophenyl)-2-diazo-1-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]ethanone.
| Compound Name | 2-(4-bromophenyl)-2-diazo-1-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]ethanone |
|---|---|
| PubChem CID | 101376119 |
| Molecular Formula | C18H20BrN3O3S |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 2-(4-bromophenyl)-2-diazo-1-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]ethanone |
| SMILES | CC1(C)[C@@H]2CC[C@]13CS(=O)(=O)N(C(=O)C(=[N+]=[N-])c1ccc(Br)cc1)[C@H]3C2 |
| InChI | InChI=1S/C18H20BrN3O3S/c1-17(2)12-7-8-18(17)10-26(24,25)22(14(18)9-12)16(23)15(21-20)11-3-5-13(19)6-4-11/h3-6,12,14H,7-10H2,1-2H3/t12-,14+,18-/m1/s1 |
| InChIKey | OLNDAHVOZDOMDN-UVBSCNOISA-N |
| XLogP | 2.83 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|