C37H50N2O6S2 — CID 123820803
(2S,5S)-2-benzyl-1,6-bis[(5S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-(2-methylprop-2-enyl)hex-3-ene-1,6-dione (PubChem CID 123820803) has the molecular formula C37H50N2O6S2 and a molecular weight of 682.95 g/mol. Its IUPAC name is (2S,5S)-2-benzyl-1,6-bis[(5S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-(2-methylprop-2-enyl)hex-3-ene-1,6-dione.
| Compound Name | (2S,5S)-2-benzyl-1,6-bis[(5S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-(2-methylprop-2-enyl)hex-3-ene-1,6-dione |
|---|---|
| PubChem CID | 123820803 |
| Molecular Formula | C37H50N2O6S2 |
| Molecular Weight | 682.95 g/mol |
| Exact Mass | 682.31 |
| IUPAC Name | (2S,5S)-2-benzyl-1,6-bis[(5S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-5-(2-methylprop-2-enyl)hex-3-ene-1,6-dione |
| SMILES | C=C(C)C[C@@H](C=C[C@H](Cc1ccccc1)C(=O)N1[C@H]2CC3CCC2(CS1(=O)=O)C3(C)C)C(=O)N1[C@H]2CC3CCC2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C37H50N2O6S2/c1-24(2)18-26(32(40)38-30-20-28-14-16-36(30,34(28,3)4)22-46(38,42)43)12-13-27(19-25-10-8-7-9-11-25)33(41)39-31-21-29-15-17-37(31,35(29,5)6)23-47(39,44)45/h7-13,26-31H,1,14-23H2,2-6H3/t26-,27-,28?,29?,30+,31+,36?,37?/m1/s1 |
| InChIKey | CNWSXZBHIVEYDS-ZPBZYMPZSA-N |
| XLogP | 5.72 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.95 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|