C22H30N2O3S3 — CID 15966940
(2R)-2-[bis(methylsulfanyl)methylideneamino]-3,3-dideuterio-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-phenyl(1,2-13C2)propan-1-one (PubChem CID 15966940) has the molecular formula C22H30N2O3S3 and a molecular weight of 471.68 g/mol. Its IUPAC name is (2R)-2-[bis(methylsulfanyl)methylideneamino]-3,3-dideuterio-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-phenyl(1,2-13C2)propan-1-one.
| Compound Name | (2R)-2-[bis(methylsulfanyl)methylideneamino]-3,3-dideuterio-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-phenyl(1,2-13C2)propan-1-one |
|---|---|
| PubChem CID | 15966940 |
| Molecular Formula | C22H30N2O3S3 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | (2R)-2-[bis(methylsulfanyl)methylideneamino]-3,3-dideuterio-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-phenyl(1,2-13C2)propan-1-one |
| SMILES | [2H]C([2H])(c1ccccc1)[13C@@H]([15N]=C(SC)SC)[13C](=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C22H30N2O3S3/c1-21(2)16-10-11-22(21)14-30(26,27)24(18(22)13-16)19(25)17(23-20(28-3)29-4)12-15-8-6-5-7-9-15/h5-9,16-18H,10-14H2,1-4H3/t16-,17-,18-,22-/m1/s1/i12D2,17+1,19+1,23+1 |
| InChIKey | FXZYTDHNPTYHGP-NXZCMMQNSA-N |
| XLogP | 4.05 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|