C30H34N2O3S — CID 134918238
(2R)-2-(benzhydrylideneamino)-1-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-(1-ethenylcyclopropyl)ethanone (PubChem CID 134918238) has the molecular formula C30H34N2O3S and a molecular weight of 502.68 g/mol. Its IUPAC name is (2R)-2-(benzhydrylideneamino)-1-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-(1-ethenylcyclopropyl)ethanone.
| Compound Name | (2R)-2-(benzhydrylideneamino)-1-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-(1-ethenylcyclopropyl)ethanone |
|---|---|
| PubChem CID | 134918238 |
| Molecular Formula | C30H34N2O3S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | (2R)-2-(benzhydrylideneamino)-1-[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-(1-ethenylcyclopropyl)ethanone |
| SMILES | C=CC1([C@@H](N=C(c2ccccc2)c2ccccc2)C(=O)N2[C@H]3C[C@H]4CC[C@]3(CS2(=O)=O)C4(C)C)CC1 |
| InChI | InChI=1S/C30H34N2O3S/c1-4-29(17-18-29)26(31-25(21-11-7-5-8-12-21)22-13-9-6-10-14-22)27(33)32-24-19-23-15-16-30(24,28(23,2)3)20-36(32,34)35/h4-14,23-24,26H,1,15-20H2,2-3H3/t23-,24+,26+,30-/m1/s1 |
| InChIKey | IETDOUFABHHRBI-YRLLVUKQSA-N |
| XLogP | 5.23 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|