C37H50N2O5S — CID 10508294
tert-butyl (9S)-9-(benzhydrylideneamino)-10-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-10-oxodecanoate (PubChem CID 10508294) has the molecular formula C37H50N2O5S and a molecular weight of 634.88 g/mol. Its IUPAC name is tert-butyl (9S)-9-(benzhydrylideneamino)-10-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-10-oxodecanoate.
| Compound Name | tert-butyl (9S)-9-(benzhydrylideneamino)-10-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-10-oxodecanoate |
|---|---|
| PubChem CID | 10508294 |
| Molecular Formula | C37H50N2O5S |
| Molecular Weight | 634.88 g/mol |
| Exact Mass | 634.34 |
| IUPAC Name | tert-butyl (9S)-9-(benzhydrylideneamino)-10-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3lambda6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-10-oxodecanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCC[C@H](N=C(c1ccccc1)c1ccccc1)C(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C37H50N2O5S/c1-35(2,3)44-32(40)22-16-8-6-7-15-21-30(38-33(27-17-11-9-12-18-27)28-19-13-10-14-20-28)34(41)39-31-25-29-23-24-37(31,36(29,4)5)26-45(39,42)43/h9-14,17-20,29-31H,6-8,15-16,21-26H2,1-5H3/t29-,30+,31-,37-/m1/s1 |
| InChIKey | BUSVDDSACNOJQE-WDJNNHDTSA-N |
| XLogP | 7.33 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.88 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|