C36H49N3O6S — CID 11215940
tert-butyl N-[(2S,3S,4R)-5-(dibenzylamino)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3,4-dimethyl-1,5-dioxopentan-2-yl]carbamate (PubChem CID 11215940) has the molecular formula C36H49N3O6S and a molecular weight of 651.87 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,4R)-5-(dibenzylamino)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3,4-dimethyl-1,5-dioxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,4R)-5-(dibenzylamino)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3,4-dimethyl-1,5-dioxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 11215940 |
| Molecular Formula | C36H49N3O6S |
| Molecular Weight | 651.87 g/mol |
| Exact Mass | 651.33 |
| IUPAC Name | tert-butyl N-[(2S,3S,4R)-5-(dibenzylamino)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3,4-dimethyl-1,5-dioxopentan-2-yl]carbamate |
| SMILES | C[C@H]([C@H](NC(=O)OC(C)(C)C)C(=O)N1[C@H]2C[C@@H]3CC[C@@]2(CS1(=O)=O)C3(C)C)[C@@H](C)C(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C36H49N3O6S/c1-24(25(2)31(40)38(21-26-14-10-8-11-15-26)22-27-16-12-9-13-17-27)30(37-33(42)45-34(3,4)5)32(41)39-29-20-28-18-19-36(29,35(28,6)7)23-46(39,43)44/h8-17,24-25,28-30H,18-23H2,1-7H3,(H,37,42)/t24-,25+,28-,29-,30-,36-/m0/s1 |
| InChIKey | HRMDVWZUFUGLSF-UDPIYVPFSA-N |
| XLogP | 5.75 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.87 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |