C23H37FN2O5S — CID 101468319
tert-butyl N-[(Z,3R)-7-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-4-fluoro-2-methyl-7-oxohept-4-en-3-yl]carbamate (PubChem CID 101468319) has the molecular formula C23H37FN2O5S and a molecular weight of 472.62 g/mol. Its IUPAC name is tert-butyl N-[(Z,3R)-7-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-4-fluoro-2-methyl-7-oxohept-4-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(Z,3R)-7-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-4-fluoro-2-methyl-7-oxohept-4-en-3-yl]carbamate |
|---|---|
| PubChem CID | 101468319 |
| Molecular Formula | C23H37FN2O5S |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | tert-butyl N-[(Z,3R)-7-(10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-4-fluoro-2-methyl-7-oxohept-4-en-3-yl]carbamate |
| SMILES | CC(C)[C@@H](NC(=O)OC(C)(C)C)/C(F)=C/CC(=O)N1C2CC3CCC2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C23H37FN2O5S/c1-14(2)19(25-20(28)31-21(3,4)5)16(24)8-9-18(27)26-17-12-15-10-11-23(17,22(15,6)7)13-32(26,29)30/h8,14-15,17,19H,9-13H2,1-7H3,(H,25,28)/b16-8-/t15?,17?,19-,23?/m1/s1 |
| InChIKey | XBOFLAHJVJMIOT-MVFARRLBSA-N |
| XLogP | 4.15 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |