C27H43FN2O5S — CID 24879870
tert-butyl N-[(3S,4Z,6R)-6-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-4-fluoro-2,8-dimethylnona-4,8-dien-3-yl]carbamate (PubChem CID 24879870) has the molecular formula C27H43FN2O5S and a molecular weight of 526.72 g/mol. Its IUPAC name is tert-butyl N-[(3S,4Z,6R)-6-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-4-fluoro-2,8-dimethylnona-4,8-dien-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4Z,6R)-6-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-4-fluoro-2,8-dimethylnona-4,8-dien-3-yl]carbamate |
|---|---|
| PubChem CID | 24879870 |
| Molecular Formula | C27H43FN2O5S |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | tert-butyl N-[(3S,4Z,6R)-6-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]-4-fluoro-2,8-dimethylnona-4,8-dien-3-yl]carbamate |
| SMILES | C=C(C)C[C@H](/C=C(\F)[C@@H](NC(=O)OC(C)(C)C)C(C)C)C(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C27H43FN2O5S/c1-16(2)12-18(13-20(28)22(17(3)4)29-24(32)35-25(5,6)7)23(31)30-21-14-19-10-11-27(21,26(19,8)9)15-36(30,33)34/h13,17-19,21-22H,1,10-12,14-15H2,2-9H3,(H,29,32)/b20-13-/t18-,19-,21-,22+,27-/m1/s1 |
| InChIKey | IMPPIYSTLJNYEY-MBONJELGSA-N |
| XLogP | 5.34 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|