C21H35NO3S — CID 89190407
(2S)-1-[(5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-prop-2-enyloctan-1-one (PubChem CID 89190407) has the molecular formula C21H35NO3S and a molecular weight of 381.58 g/mol. Its IUPAC name is (2S)-1-[(5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-prop-2-enyloctan-1-one.
| Compound Name | (2S)-1-[(5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-prop-2-enyloctan-1-one |
|---|---|
| PubChem CID | 89190407 |
| Molecular Formula | C21H35NO3S |
| Molecular Weight | 381.58 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (2S)-1-[(5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-prop-2-enyloctan-1-one |
| SMILES | C=CCC(CCCCCC)C(=O)N1[C@@H]2C[C@H]3CCC2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C21H35NO3S/c1-5-7-8-9-11-16(10-6-2)19(23)22-18-14-17-12-13-21(18,20(17,3)4)15-26(22,24)25/h6,16-18H,2,5,7-15H2,1,3-4H3/t16?,17-,18-,21?/m1/s1 |
| InChIKey | ZEVKAGAUWZYMGI-BKVYSMKUSA-N |
| XLogP | 4.52 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|