C31H53NO6S — CID 101383253
(2S)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-hydroxy-2-[(2R,5S)-5-[(Z,1S)-1-hydroxypentadec-4-enyl]oxolan-2-yl]ethanone (PubChem CID 101383253) has the molecular formula C31H53NO6S and a molecular weight of 567.83 g/mol. Its IUPAC name is (2S)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-hydroxy-2-[(2R,5S)-5-[(Z,1S)-1-hydroxypentadec-4-enyl]oxolan-2-yl]ethanone.
| Compound Name | (2S)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-hydroxy-2-[(2R,5S)-5-[(Z,1S)-1-hydroxypentadec-4-enyl]oxolan-2-yl]ethanone |
|---|---|
| PubChem CID | 101383253 |
| Molecular Formula | C31H53NO6S |
| Molecular Weight | 567.83 g/mol |
| Exact Mass | 567.36 |
| IUPAC Name | (2S)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-hydroxy-2-[(2R,5S)-5-[(Z,1S)-1-hydroxypentadec-4-enyl]oxolan-2-yl]ethanone |
| SMILES | CCCCCCCCCC/C=C\CC[C@H](O)[C@@H]1CC[C@H]([C@H](O)C(=O)N2[C@H]3C[C@@H]4CC[C@@]3(CS2(=O)=O)C4(C)C)O1 |
| InChI | InChI=1S/C31H53NO6S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-24(33)25-17-18-26(38-25)28(34)29(35)32-27-21-23-19-20-31(27,30(23,2)3)22-39(32,36)37/h13-14,23-28,33-34H,4-12,15-22H2,1-3H3/b14-13-/t23-,24-,25-,26+,27-,28-,31-/m0/s1 |
| InChIKey | MHAWDUIQLJYZRO-PNXSSEOOSA-N |
| XLogP | 5.49 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.83 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|