C37H68O7 — CID 171121378
(5S)-5-methyl-3-[(2R,13R)-2,8,13-trihydroxy-13-[(2R,5R)-5-[(Z,1R)-1-hydroxypentadec-4-enyl]oxolan-2-yl]tridecyl]oxolan-2-one (PubChem CID 171121378) has the molecular formula C37H68O7 and a molecular weight of 624.94 g/mol. Its IUPAC name is (5S)-5-methyl-3-[(2R,13R)-2,8,13-trihydroxy-13-[(2R,5R)-5-[(Z,1R)-1-hydroxypentadec-4-enyl]oxolan-2-yl]tridecyl]oxolan-2-one.
| Compound Name | (5S)-5-methyl-3-[(2R,13R)-2,8,13-trihydroxy-13-[(2R,5R)-5-[(Z,1R)-1-hydroxypentadec-4-enyl]oxolan-2-yl]tridecyl]oxolan-2-one |
|---|---|
| PubChem CID | 171121378 |
| Molecular Formula | C37H68O7 |
| Molecular Weight | 624.94 g/mol |
| Exact Mass | 624.50 |
| IUPAC Name | (5S)-5-methyl-3-[(2R,13R)-2,8,13-trihydroxy-13-[(2R,5R)-5-[(Z,1R)-1-hydroxypentadec-4-enyl]oxolan-2-yl]tridecyl]oxolan-2-one |
| SMILES | CCCCCCCCCC/C=C\CC[C@@H](O)[C@H]1CC[C@H]([C@H](O)CCCCC(O)CCCCC[C@@H](O)CC2C[C@H](C)OC2=O)O1 |
| InChI | InChI=1S/C37H68O7/c1-3-4-5-6-7-8-9-10-11-12-13-17-23-33(40)35-25-26-36(44-35)34(41)24-19-18-21-31(38)20-15-14-16-22-32(39)28-30-27-29(2)43-37(30)42/h12-13,29-36,38-41H,3-11,14-28H2,1-2H3/b13-12-/t29-,30?,31?,32+,33+,34+,35+,36+/m0/s1 |
| InChIKey | SHAKTEAAWDSPKZ-ZRIHOTOYSA-N |
| XLogP | 7.70 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.94 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|