C37H66O6 — CID 177443924
(2S)-4-[(2R,13R)-2,13-dihydroxy-13-[(2R,5R)-5-[(Z)-1-hydroxypentadec-4-enyl]oxolan-2-yl]tridecyl]-2-methyl-2H-furan-5-one (PubChem CID 177443924) has the molecular formula C37H66O6 and a molecular weight of 606.93 g/mol. Its IUPAC name is (2S)-4-[(2R,13R)-2,13-dihydroxy-13-[(2R,5R)-5-[(Z)-1-hydroxypentadec-4-enyl]oxolan-2-yl]tridecyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2S)-4-[(2R,13R)-2,13-dihydroxy-13-[(2R,5R)-5-[(Z)-1-hydroxypentadec-4-enyl]oxolan-2-yl]tridecyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 177443924 |
| Molecular Formula | C37H66O6 |
| Molecular Weight | 606.93 g/mol |
| Exact Mass | 606.49 |
| IUPAC Name | (2S)-4-[(2R,13R)-2,13-dihydroxy-13-[(2R,5R)-5-[(Z)-1-hydroxypentadec-4-enyl]oxolan-2-yl]tridecyl]-2-methyl-2H-furan-5-one |
| SMILES | CCCCCCCCCC/C=C\CCC(O)[C@H]1CC[C@H]([C@H](O)CCCCCCCCCC[C@@H](O)CC2=C[C@H](C)OC2=O)O1 |
| InChI | InChI=1S/C37H66O6/c1-3-4-5-6-7-8-9-10-11-15-18-21-24-33(39)35-26-27-36(43-35)34(40)25-22-19-16-13-12-14-17-20-23-32(38)29-31-28-30(2)42-37(31)41/h15,18,28,30,32-36,38-40H,3-14,16-17,19-27,29H2,1-2H3/b18-15-/t30-,32+,33?,34+,35+,36+/m0/s1 |
| InChIKey | OZWNHDYKRQUFSF-CSFAYSPUSA-N |
| XLogP | 8.65 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.93 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|