C36H62O7 — CID 10416253
(5R)-5-[(11R)-11-hydroxy-11-[(5R)-5-[(Z,1R)-1-hydroxytetradec-4-enyl]oxolan-2-yl]-5-oxoundecyl]-3-(2-oxopropyl)oxolan-2-one (PubChem CID 10416253) has the molecular formula C36H62O7 and a molecular weight of 606.89 g/mol. Its IUPAC name is (5R)-5-[(11R)-11-hydroxy-11-[(5R)-5-[(Z,1R)-1-hydroxytetradec-4-enyl]oxolan-2-yl]-5-oxoundecyl]-3-(2-oxopropyl)oxolan-2-one.
| Compound Name | (5R)-5-[(11R)-11-hydroxy-11-[(5R)-5-[(Z,1R)-1-hydroxytetradec-4-enyl]oxolan-2-yl]-5-oxoundecyl]-3-(2-oxopropyl)oxolan-2-one |
|---|---|
| PubChem CID | 10416253 |
| Molecular Formula | C36H62O7 |
| Molecular Weight | 606.89 g/mol |
| Exact Mass | 606.45 |
| IUPAC Name | (5R)-5-[(11R)-11-hydroxy-11-[(5R)-5-[(Z,1R)-1-hydroxytetradec-4-enyl]oxolan-2-yl]-5-oxoundecyl]-3-(2-oxopropyl)oxolan-2-one |
| SMILES | CCCCCCCCC/C=C\CC[C@@H](O)[C@H]1CCC([C@H](O)CCCCCC(=O)CCCC[C@@H]2CC(CC(C)=O)C(=O)O2)O1 |
| InChI | InChI=1S/C36H62O7/c1-3-4-5-6-7-8-9-10-11-12-15-22-32(39)34-24-25-35(43-34)33(40)23-16-13-14-19-30(38)20-17-18-21-31-27-29(26-28(2)37)36(41)42-31/h11-12,29,31-35,39-40H,3-10,13-27H2,1-2H3/b12-11-/t29?,31-,32-,33-,34-,35?/m1/s1 |
| InChIKey | MFMVPOLQJBZZHS-NRAHIVNPSA-N |
| XLogP | 7.72 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.89 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|