C35H59NO10S — CID 25214078
[(1S,4S,5S)-1-[(2S,5R)-5-[(1S)-1-acetyloxy-2-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-oxoethyl]oxolan-2-yl]-4,5-dihydroxypentadecyl] acetate (PubChem CID 25214078) has the molecular formula C35H59NO10S and a molecular weight of 685.92 g/mol. Its IUPAC name is [(1S,4S,5S)-1-[(2S,5R)-5-[(1S)-1-acetyloxy-2-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-oxoethyl]oxolan-2-yl]-4,5-dihydroxypentadecyl] acetate.
| Compound Name | [(1S,4S,5S)-1-[(2S,5R)-5-[(1S)-1-acetyloxy-2-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-oxoethyl]oxolan-2-yl]-4,5-dihydroxypentadecyl] acetate |
|---|---|
| PubChem CID | 25214078 |
| Molecular Formula | C35H59NO10S |
| Molecular Weight | 685.92 g/mol |
| Exact Mass | 685.39 |
| IUPAC Name | [(1S,4S,5S)-1-[(2S,5R)-5-[(1S)-1-acetyloxy-2-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-oxoethyl]oxolan-2-yl]-4,5-dihydroxypentadecyl] acetate |
| SMILES | CCCCCCCCCC[C@H](O)[C@@H](O)CC[C@H](OC(C)=O)[C@@H]1CC[C@H]([C@H](OC(C)=O)C(=O)N2[C@H]3C[C@@H]4CC[C@@]3(CS2(=O)=O)C4(C)C)O1 |
| InChI | InChI=1S/C35H59NO10S/c1-6-7-8-9-10-11-12-13-14-26(39)27(40)15-16-28(44-23(2)37)29-17-18-30(46-29)32(45-24(3)38)33(41)36-31-21-25-19-20-35(31,34(25,4)5)22-47(36,42)43/h25-32,39-40H,6-22H2,1-5H3/t25-,26-,27-,28-,29-,30+,31-,32-,35-/m0/s1 |
| InChIKey | HFRWZEIEZAOYSS-VUMWMICDSA-N |
| XLogP | 4.80 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.92 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|