C31H48N2O6S — CID 155628371
benzyl N-[(2S)-2-[(2R,3R)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-methyl-1-oxononan-3-yl]oxypropyl]carbamate (PubChem CID 155628371) has the molecular formula C31H48N2O6S and a molecular weight of 576.80 g/mol. Its IUPAC name is benzyl N-[(2S)-2-[(2R,3R)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-methyl-1-oxononan-3-yl]oxypropyl]carbamate.
| Compound Name | benzyl N-[(2S)-2-[(2R,3R)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-methyl-1-oxononan-3-yl]oxypropyl]carbamate |
|---|---|
| PubChem CID | 155628371 |
| Molecular Formula | C31H48N2O6S |
| Molecular Weight | 576.80 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | benzyl N-[(2S)-2-[(2R,3R)-1-[(1R,5S,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-2-methyl-1-oxononan-3-yl]oxypropyl]carbamate |
| SMILES | CCCCCC[C@@H](O[C@@H](C)CNC(=O)OCc1ccccc1)[C@@H](C)C(=O)N1[C@H]2C[C@@H]3CC[C@@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C31H48N2O6S/c1-6-7-8-12-15-26(39-22(2)19-32-29(35)38-20-24-13-10-9-11-14-24)23(3)28(34)33-27-18-25-16-17-31(27,30(25,4)5)21-40(33,36)37/h9-11,13-14,22-23,25-27H,6-8,12,15-21H2,1-5H3,(H,32,35)/t22-,23+,25-,26+,27-,31-/m0/s1 |
| InChIKey | FSSWERFZINAQIT-STMFYMRRSA-N |
| XLogP | 5.66 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.80 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|