C17H27NO4S — CID 134904169
(2S,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-hydroxy-2,4-dimethylpent-4-en-1-one (PubChem CID 134904169) has the molecular formula C17H27NO4S and a molecular weight of 341.47 g/mol. Its IUPAC name is (2S,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-hydroxy-2,4-dimethylpent-4-en-1-one.
| Compound Name | (2S,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-hydroxy-2,4-dimethylpent-4-en-1-one |
|---|---|
| PubChem CID | 134904169 |
| Molecular Formula | C17H27NO4S |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (2S,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-3-hydroxy-2,4-dimethylpent-4-en-1-one |
| SMILES | C=C(C)[C@H](O)[C@H](C)C(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C17H27NO4S/c1-10(2)14(19)11(3)15(20)18-13-8-12-6-7-17(13,16(12,4)5)9-23(18,21)22/h11-14,19H,1,6-9H2,2-5H3/t11-,12+,13+,14-,17+/m0/s1 |
| InChIKey | DRDASALIOZQDDC-GMIGGYDBSA-N |
| XLogP | 1.93 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|